C18H28N2O3 — CID 119679429
(2S)-N-(3,4-dipropoxyphenyl)piperidine-2-carboxamide (PubChem CID 119679429) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is (2S)-N-(3,4-dipropoxyphenyl)piperidine-2-carboxamide.
| Compound Name | (2S)-N-(3,4-dipropoxyphenyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 119679429 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | (2S)-N-(3,4-dipropoxyphenyl)piperidine-2-carboxamide |
| SMILES | CCCOc1ccc(NC(=O)[C@@H]2CCCCN2)cc1OCCC |
| InChI | InChI=1S/C18H28N2O3/c1-3-11-22-16-9-8-14(13-17(16)23-12-4-2)20-18(21)15-7-5-6-10-19-15/h8-9,13,15,19H,3-7,10-12H2,1-2H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | VGNFDWTZDRGQEA-HNNXBMFYSA-N |
| XLogP | 3.34 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |