C14H20N2O4 — CID 104900490
(2R)-N-[3-(2-hydroxyethoxy)-4-methoxyphenyl]pyrrolidine-2-carboxamide (PubChem CID 104900490) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is (2R)-N-[3-(2-hydroxyethoxy)-4-methoxyphenyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[3-(2-hydroxyethoxy)-4-methoxyphenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 104900490 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | (2R)-N-[3-(2-hydroxyethoxy)-4-methoxyphenyl]pyrrolidine-2-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@H]2CCCN2)cc1OCCO |
| InChI | InChI=1S/C14H20N2O4/c1-19-12-5-4-10(9-13(12)20-8-7-17)16-14(18)11-3-2-6-15-11/h4-5,9,11,15,17H,2-3,6-8H2,1H3,(H,16,18)/t11-/m1/s1 |
| InChIKey | ANQDBNCMWMRJMO-LLVKDONJSA-N |
| XLogP | 0.76 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |