C18H19ClN2O4S — CID 175745588
N-[5-chloro-2-(2-methoxyethoxy)phenyl]-5-(cyclopropanecarbonylamino)thiophene-2-carboxamide (PubChem CID 175745588) has the molecular formula C18H19ClN2O4S and a molecular weight of 394.88 g/mol. Its IUPAC name is N-[5-chloro-2-(2-methoxyethoxy)phenyl]-5-(cyclopropanecarbonylamino)thiophene-2-carboxamide.
| Compound Name | N-[5-chloro-2-(2-methoxyethoxy)phenyl]-5-(cyclopropanecarbonylamino)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 175745588 |
| Molecular Formula | C18H19ClN2O4S |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | N-[5-chloro-2-(2-methoxyethoxy)phenyl]-5-(cyclopropanecarbonylamino)thiophene-2-carboxamide |
| SMILES | COCCOc1ccc(Cl)cc1NC(=O)c1ccc(NC(=O)C2CC2)s1 |
| InChI | InChI=1S/C18H19ClN2O4S/c1-24-8-9-25-14-5-4-12(19)10-13(14)20-18(23)15-6-7-16(26-15)21-17(22)11-2-3-11/h4-7,10-11H,2-3,8-9H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | KMHJFMYQOQMZCJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|