C19H22ClNO6 — CID 2980127
N-[5-chloro-2-(2-methoxyethoxy)phenyl]-3,4,5-trimethoxybenzamide (PubChem CID 2980127) has the molecular formula C19H22ClNO6 and a molecular weight of 395.84 g/mol. Its IUPAC name is N-[5-chloro-2-(2-methoxyethoxy)phenyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[5-chloro-2-(2-methoxyethoxy)phenyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 2980127 |
| Molecular Formula | C19H22ClNO6 |
| Molecular Weight | 395.84 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | N-[5-chloro-2-(2-methoxyethoxy)phenyl]-3,4,5-trimethoxybenzamide |
| SMILES | COCCOc1ccc(Cl)cc1NC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C19H22ClNO6/c1-23-7-8-27-15-6-5-13(20)11-14(15)21-19(22)12-9-16(24-2)18(26-4)17(10-12)25-3/h5-6,9-11H,7-8H2,1-4H3,(H,21,22) |
| InChIKey | NXCYAEMRTRALGB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.84 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|