C24H21Cl2N3O6 — CID 126005822
N-[2-[[(2,4-dichlorobenzoyl)amino]carbamoyl]phenyl]-3,4,5-trimethoxybenzamide (PubChem CID 126005822) has the molecular formula C24H21Cl2N3O6 and a molecular weight of 518.35 g/mol. Its IUPAC name is N-[2-[[(2,4-dichlorobenzoyl)amino]carbamoyl]phenyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-[[(2,4-dichlorobenzoyl)amino]carbamoyl]phenyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 126005822 |
| Molecular Formula | C24H21Cl2N3O6 |
| Molecular Weight | 518.35 g/mol |
| Exact Mass | 517.08 |
| IUPAC Name | N-[2-[[(2,4-dichlorobenzoyl)amino]carbamoyl]phenyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccccc2C(=O)NNC(=O)c2ccc(Cl)cc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C24H21Cl2N3O6/c1-33-19-10-13(11-20(34-2)21(19)35-3)22(30)27-18-7-5-4-6-16(18)24(32)29-28-23(31)15-9-8-14(25)12-17(15)26/h4-12H,1-3H3,(H,27,30)(H,28,31)(H,29,32) |
| InChIKey | TUIYVFKIPMMFBY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.35 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|