C22H28N3O5+ — CID 7258591
3,4,5-trimethoxy-N-[2-(4-methylpiperazin-4-ium-1-carbonyl)phenyl]benzamide (PubChem CID 7258591) has the molecular formula C22H28N3O5+ and a molecular weight of 414.48 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[2-(4-methylpiperazin-4-ium-1-carbonyl)phenyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[2-(4-methylpiperazin-4-ium-1-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 7258591 |
| Molecular Formula | C22H28N3O5+ |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 3,4,5-trimethoxy-N-[2-(4-methylpiperazin-4-ium-1-carbonyl)phenyl]benzamide |
| SMILES | COc1cc(C(=O)Nc2ccccc2C(=O)N2CC[NH+](C)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C22H27N3O5/c1-24-9-11-25(12-10-24)22(27)16-7-5-6-8-17(16)23-21(26)15-13-18(28-2)20(30-4)19(14-15)29-3/h5-8,13-14H,9-12H2,1-4H3,(H,23,26)/p+1 |
| InChIKey | SBHMREOUSNLKKP-UHFFFAOYSA-O |
| XLogP | 0.94 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |