C19H21FN3O2+ — CID 6920712
4-fluoro-N-[2-(4-methylpiperazin-4-ium-1-carbonyl)phenyl]benzamide (PubChem CID 6920712) has the molecular formula C19H21FN3O2+ and a molecular weight of 342.39 g/mol. Its IUPAC name is 4-fluoro-N-[2-(4-methylpiperazin-4-ium-1-carbonyl)phenyl]benzamide.
| Compound Name | 4-fluoro-N-[2-(4-methylpiperazin-4-ium-1-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 6920712 |
| Molecular Formula | C19H21FN3O2+ |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 4-fluoro-N-[2-(4-methylpiperazin-4-ium-1-carbonyl)phenyl]benzamide |
| SMILES | C[NH+]1CCN(C(=O)c2ccccc2NC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H20FN3O2/c1-22-10-12-23(13-11-22)19(25)16-4-2-3-5-17(16)21-18(24)14-6-8-15(20)9-7-14/h2-9H,10-13H2,1H3,(H,21,24)/p+1 |
| InChIKey | WEZCDFAHERGUAW-UHFFFAOYSA-O |
| XLogP | 1.05 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |