C26H28N3O2+ — CID 4048530
N-[2-(4-benzylpiperazin-4-ium-1-carbonyl)phenyl]-4-methylbenzamide (PubChem CID 4048530) has the molecular formula C26H28N3O2+ and a molecular weight of 414.53 g/mol. Its IUPAC name is N-[2-(4-benzylpiperazin-4-ium-1-carbonyl)phenyl]-4-methylbenzamide.
| Compound Name | N-[2-(4-benzylpiperazin-4-ium-1-carbonyl)phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 4048530 |
| Molecular Formula | C26H28N3O2+ |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | N-[2-(4-benzylpiperazin-4-ium-1-carbonyl)phenyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccccc2C(=O)N2CC[NH+](Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H27N3O2/c1-20-11-13-22(14-12-20)25(30)27-24-10-6-5-9-23(24)26(31)29-17-15-28(16-18-29)19-21-7-3-2-4-8-21/h2-14H,15-19H2,1H3,(H,27,30)/p+1 |
| InChIKey | SREDBHQUIGOOLY-UHFFFAOYSA-O |
| XLogP | 2.79 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |