C29H30N4O5 — CID 17119641
ethyl 4-[2-[[4-[(2-phenylacetyl)amino]benzoyl]amino]benzoyl]piperazine-1-carboxylate (PubChem CID 17119641) has the molecular formula C29H30N4O5 and a molecular weight of 514.58 g/mol. Its IUPAC name is ethyl 4-[2-[[4-[(2-phenylacetyl)amino]benzoyl]amino]benzoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[[4-[(2-phenylacetyl)amino]benzoyl]amino]benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 17119641 |
| Molecular Formula | C29H30N4O5 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | ethyl 4-[2-[[4-[(2-phenylacetyl)amino]benzoyl]amino]benzoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2ccccc2NC(=O)c2ccc(NC(=O)Cc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C29H30N4O5/c1-2-38-29(37)33-18-16-32(17-19-33)28(36)24-10-6-7-11-25(24)31-27(35)22-12-14-23(15-13-22)30-26(34)20-21-8-4-3-5-9-21/h3-15H,2,16-20H2,1H3,(H,30,34)(H,31,35) |
| InChIKey | SMXHYEPTXKVIED-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |