C16H18Cl3N3O4 — CID 17311910
ethyl 4-[2-[(2,2,2-trichloroacetyl)amino]benzoyl]piperazine-1-carboxylate (PubChem CID 17311910) has the molecular formula C16H18Cl3N3O4 and a molecular weight of 422.70 g/mol. Its IUPAC name is ethyl 4-[2-[(2,2,2-trichloroacetyl)amino]benzoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[(2,2,2-trichloroacetyl)amino]benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 17311910 |
| Molecular Formula | C16H18Cl3N3O4 |
| Molecular Weight | 422.70 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | ethyl 4-[2-[(2,2,2-trichloroacetyl)amino]benzoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2ccccc2NC(=O)C(Cl)(Cl)Cl)CC1 |
| InChI | InChI=1S/C16H18Cl3N3O4/c1-2-26-15(25)22-9-7-21(8-10-22)13(23)11-5-3-4-6-12(11)20-14(24)16(17,18)19/h3-6H,2,7-10H2,1H3,(H,20,24) |
| InChIKey | GKUBSDKJTHOLMS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.70 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|