C22H25N3O4 — CID 2984971
ethyl 4-[2-[(3-methylbenzoyl)amino]benzoyl]piperazine-1-carboxylate (PubChem CID 2984971) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is ethyl 4-[2-[(3-methylbenzoyl)amino]benzoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[(3-methylbenzoyl)amino]benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 2984971 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | ethyl 4-[2-[(3-methylbenzoyl)amino]benzoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2ccccc2NC(=O)c2cccc(C)c2)CC1 |
| InChI | InChI=1S/C22H25N3O4/c1-3-29-22(28)25-13-11-24(12-14-25)21(27)18-9-4-5-10-19(18)23-20(26)17-8-6-7-16(2)15-17/h4-10,15H,3,11-14H2,1-2H3,(H,23,26) |
| InChIKey | OWBPNNDBODJCGJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |