C21H22N4O6 — CID 17311376
ethyl 4-[2-[(2-nitrobenzoyl)amino]benzoyl]piperazine-1-carboxylate (PubChem CID 17311376) has the molecular formula C21H22N4O6 and a molecular weight of 426.43 g/mol. Its IUPAC name is ethyl 4-[2-[(2-nitrobenzoyl)amino]benzoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[(2-nitrobenzoyl)amino]benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 17311376 |
| Molecular Formula | C21H22N4O6 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | ethyl 4-[2-[(2-nitrobenzoyl)amino]benzoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2ccccc2NC(=O)c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H22N4O6/c1-2-31-21(28)24-13-11-23(12-14-24)20(27)15-7-3-5-9-17(15)22-19(26)16-8-4-6-10-18(16)25(29)30/h3-10H,2,11-14H2,1H3,(H,22,26) |
| InChIKey | GLMOXHSHKZKRPI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|