C21H21ClN4O6 — CID 17311526
ethyl 4-[2-[(4-chloro-2-nitrobenzoyl)amino]benzoyl]piperazine-1-carboxylate (PubChem CID 17311526) has the molecular formula C21H21ClN4O6 and a molecular weight of 460.87 g/mol. Its IUPAC name is ethyl 4-[2-[(4-chloro-2-nitrobenzoyl)amino]benzoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[(4-chloro-2-nitrobenzoyl)amino]benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 17311526 |
| Molecular Formula | C21H21ClN4O6 |
| Molecular Weight | 460.87 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | ethyl 4-[2-[(4-chloro-2-nitrobenzoyl)amino]benzoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2ccccc2NC(=O)c2ccc(Cl)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H21ClN4O6/c1-2-32-21(29)25-11-9-24(10-12-25)20(28)15-5-3-4-6-17(15)23-19(27)16-8-7-14(22)13-18(16)26(30)31/h3-8,13H,2,9-12H2,1H3,(H,23,27) |
| InChIKey | LCGUZVZHGZJKNV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.87 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|