C22H33N3O4 — CID 17311766
ethyl 4-[2-(2-ethylhexanoylamino)benzoyl]piperazine-1-carboxylate (PubChem CID 17311766) has the molecular formula C22H33N3O4 and a molecular weight of 403.52 g/mol. Its IUPAC name is ethyl 4-[2-(2-ethylhexanoylamino)benzoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-(2-ethylhexanoylamino)benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 17311766 |
| Molecular Formula | C22H33N3O4 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | ethyl 4-[2-(2-ethylhexanoylamino)benzoyl]piperazine-1-carboxylate |
| SMILES | CCCCC(CC)C(=O)Nc1ccccc1C(=O)N1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C22H33N3O4/c1-4-7-10-17(5-2)20(26)23-19-12-9-8-11-18(19)21(27)24-13-15-25(16-14-24)22(28)29-6-3/h8-9,11-12,17H,4-7,10,13-16H2,1-3H3,(H,23,26) |
| InChIKey | HVZKJHOOKLBPEG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |