C26H29N4OS+ — CID 6985411
N-[[4-(4-benzylpiperazin-4-ium-1-yl)phenyl]carbamothioyl]-4-methylbenzamide (PubChem CID 6985411) has the molecular formula C26H29N4OS+ and a molecular weight of 445.61 g/mol. Its IUPAC name is N-[[4-(4-benzylpiperazin-4-ium-1-yl)phenyl]carbamothioyl]-4-methylbenzamide.
| Compound Name | N-[[4-(4-benzylpiperazin-4-ium-1-yl)phenyl]carbamothioyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 6985411 |
| Molecular Formula | C26H29N4OS+ |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | N-[[4-(4-benzylpiperazin-4-ium-1-yl)phenyl]carbamothioyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2ccc(N3CC[NH+](Cc4ccccc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C26H28N4OS/c1-20-7-9-22(10-8-20)25(31)28-26(32)27-23-11-13-24(14-12-23)30-17-15-29(16-18-30)19-21-5-3-2-4-6-21/h2-14H,15-19H2,1H3,(H2,27,28,31,32)/p+1 |
| InChIKey | HPVPWTPSUNUINF-UHFFFAOYSA-O |
| XLogP | 3.03 |
| TPSA | 48.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|