C23H22N4O3S — CID 978363
N-[[4-(4-benzoylpiperazin-1-yl)phenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 978363) has the molecular formula C23H22N4O3S and a molecular weight of 434.52 g/mol. Its IUPAC name is N-[[4-(4-benzoylpiperazin-1-yl)phenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | N-[[4-(4-benzoylpiperazin-1-yl)phenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 978363 |
| Molecular Formula | C23H22N4O3S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | N-[[4-(4-benzoylpiperazin-1-yl)phenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCN(C(=O)c3ccccc3)CC2)cc1)c1ccco1 |
| InChI | InChI=1S/C23H22N4O3S/c28-21(20-7-4-16-30-20)25-23(31)24-18-8-10-19(11-9-18)26-12-14-27(15-13-26)22(29)17-5-2-1-3-6-17/h1-11,16H,12-15H2,(H2,24,25,28,31) |
| InChIKey | IHKLQGVGMCNMCE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|