C30H28N4O3S — CID 17317961
N-[[4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-2,2-diphenylacetamide (PubChem CID 17317961) has the molecular formula C30H28N4O3S and a molecular weight of 524.65 g/mol. Its IUPAC name is N-[[4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-2,2-diphenylacetamide.
| Compound Name | N-[[4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 17317961 |
| Molecular Formula | C30H28N4O3S |
| Molecular Weight | 524.65 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | N-[[4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-2,2-diphenylacetamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCN(C(=O)c3ccco3)CC2)cc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H28N4O3S/c35-28(27(22-8-3-1-4-9-22)23-10-5-2-6-11-23)32-30(38)31-24-13-15-25(16-14-24)33-17-19-34(20-18-33)29(36)26-12-7-21-37-26/h1-16,21,27H,17-20H2,(H2,31,32,35,38) |
| InChIKey | DOZSAPRKHTXGGT-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.65 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|