C27H23ClN4O3S — CID 1254630
N-[[4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-1-benzofuran-2-carboxamide (PubChem CID 1254630) has the molecular formula C27H23ClN4O3S and a molecular weight of 519.03 g/mol. Its IUPAC name is N-[[4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[[4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 1254630 |
| Molecular Formula | C27H23ClN4O3S |
| Molecular Weight | 519.03 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | N-[[4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCN(C(=O)c3ccc(Cl)cc3)CC2)cc1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C27H23ClN4O3S/c28-20-7-5-18(6-8-20)26(34)32-15-13-31(14-16-32)22-11-9-21(10-12-22)29-27(36)30-25(33)24-17-19-3-1-2-4-23(19)35-24/h1-12,17H,13-16H2,(H2,29,30,33,36) |
| InChIKey | YEALTMUNAPHLOE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.03 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|