C31H30N6O6S — CID 43913813
N-[[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide (PubChem CID 43913813) has the molecular formula C31H30N6O6S and a molecular weight of 614.68 g/mol. Its IUPAC name is N-[[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide.
| Compound Name | N-[[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 43913813 |
| Molecular Formula | C31H30N6O6S |
| Molecular Weight | 614.68 g/mol |
| Exact Mass | 614.19 |
| IUPAC Name | N-[[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCN(C(=O)c3cc4ccccc4o3)CC2)cc1)c1ccc(N2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H30N6O6S/c38-29(22-5-10-25(26(19-22)37(40)41)35-15-17-42-18-16-35)33-31(44)32-23-6-8-24(9-7-23)34-11-13-36(14-12-34)30(39)28-20-21-3-1-2-4-27(21)43-28/h1-10,19-20H,11-18H2,(H2,32,33,38,44) |
| InChIKey | DXIVXJZEBWPQMO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 133.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.68 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|