C32H33N5O5 — CID 43914501
N-[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]phenyl]-4-(4-methylpiperidin-1-yl)-3-nitrobenzamide (PubChem CID 43914501) has the molecular formula C32H33N5O5 and a molecular weight of 567.65 g/mol. Its IUPAC name is N-[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]phenyl]-4-(4-methylpiperidin-1-yl)-3-nitrobenzamide.
| Compound Name | N-[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]phenyl]-4-(4-methylpiperidin-1-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 43914501 |
| Molecular Formula | C32H33N5O5 |
| Molecular Weight | 567.65 g/mol |
| Exact Mass | 567.25 |
| IUPAC Name | N-[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]phenyl]-4-(4-methylpiperidin-1-yl)-3-nitrobenzamide |
| SMILES | CC1CCN(c2ccc(C(=O)Nc3ccc(N4CCN(C(=O)c5cc6ccccc6o5)CC4)cc3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C32H33N5O5/c1-22-12-14-35(15-13-22)27-11-6-24(20-28(27)37(40)41)31(38)33-25-7-9-26(10-8-25)34-16-18-36(19-17-34)32(39)30-21-23-4-2-3-5-29(23)42-30/h2-11,20-22H,12-19H2,1H3,(H,33,38) |
| InChIKey | PZBGUFVWVHVFBS-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 112.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.65 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|