C30H34N4O4 — CID 17274373
N-[4-[(4-tert-butylbenzoyl)amino]phenyl]-4-(4-methylpiperidin-1-yl)-3-nitrobenzamide (PubChem CID 17274373) has the molecular formula C30H34N4O4 and a molecular weight of 514.63 g/mol. Its IUPAC name is N-[4-[(4-tert-butylbenzoyl)amino]phenyl]-4-(4-methylpiperidin-1-yl)-3-nitrobenzamide.
| Compound Name | N-[4-[(4-tert-butylbenzoyl)amino]phenyl]-4-(4-methylpiperidin-1-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 17274373 |
| Molecular Formula | C30H34N4O4 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | N-[4-[(4-tert-butylbenzoyl)amino]phenyl]-4-(4-methylpiperidin-1-yl)-3-nitrobenzamide |
| SMILES | CC1CCN(c2ccc(C(=O)Nc3ccc(NC(=O)c4ccc(C(C)(C)C)cc4)cc3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C30H34N4O4/c1-20-15-17-33(18-16-20)26-14-7-22(19-27(26)34(37)38)29(36)32-25-12-10-24(11-13-25)31-28(35)21-5-8-23(9-6-21)30(2,3)4/h5-14,19-20H,15-18H2,1-4H3,(H,31,35)(H,32,36) |
| InChIKey | FCKZEEUTYWQKPK-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|