C28H37N5O4 — CID 17335378
N-[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]-4-(4-methylpiperidin-1-yl)-3-nitrobenzamide (PubChem CID 17335378) has the molecular formula C28H37N5O4 and a molecular weight of 507.64 g/mol. Its IUPAC name is N-[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]-4-(4-methylpiperidin-1-yl)-3-nitrobenzamide.
| Compound Name | N-[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]-4-(4-methylpiperidin-1-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 17335378 |
| Molecular Formula | C28H37N5O4 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | N-[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]-4-(4-methylpiperidin-1-yl)-3-nitrobenzamide |
| SMILES | CC(C)CC(=O)N1CCN(c2ccc(NC(=O)c3ccc(N4CCC(C)CC4)c([N+](=O)[O-])c3)cc2)CC1 |
| InChI | InChI=1S/C28H37N5O4/c1-20(2)18-27(34)32-16-14-30(15-17-32)24-7-5-23(6-8-24)29-28(35)22-4-9-25(26(19-22)33(36)37)31-12-10-21(3)11-13-31/h4-9,19-21H,10-18H2,1-3H3,(H,29,35) |
| InChIKey | WSWGUZJFMHRRPC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|