C23H27N5O5 — CID 27231943
[4-(4-methylpiperidin-1-yl)-3-nitrophenyl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 27231943) has the molecular formula C23H27N5O5 and a molecular weight of 453.50 g/mol. Its IUPAC name is [4-(4-methylpiperidin-1-yl)-3-nitrophenyl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | [4-(4-methylpiperidin-1-yl)-3-nitrophenyl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 27231943 |
| Molecular Formula | C23H27N5O5 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | [4-(4-methylpiperidin-1-yl)-3-nitrophenyl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | CC1CCN(c2ccc(C(=O)N3CCN(c4ccc([N+](=O)[O-])cc4)CC3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C23H27N5O5/c1-17-8-10-25(11-9-17)21-7-2-18(16-22(21)28(32)33)23(29)26-14-12-24(13-15-26)19-3-5-20(6-4-19)27(30)31/h2-7,16-17H,8-15H2,1H3 |
| InChIKey | WWTPEKOOQZLDOX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 113.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|