C23H28N4O4 — CID 8779380
[4-(azepan-1-yl)-3-nitrophenyl]-[4-(4-hydroxyphenyl)piperazin-1-yl]methanone (PubChem CID 8779380) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is [4-(azepan-1-yl)-3-nitrophenyl]-[4-(4-hydroxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [4-(azepan-1-yl)-3-nitrophenyl]-[4-(4-hydroxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 8779380 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | [4-(azepan-1-yl)-3-nitrophenyl]-[4-(4-hydroxyphenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(N2CCCCCC2)c([N+](=O)[O-])c1)N1CCN(c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C23H28N4O4/c28-20-8-6-19(7-9-20)24-13-15-26(16-14-24)23(29)18-5-10-21(22(17-18)27(30)31)25-11-3-1-2-4-12-25/h5-10,17,28H,1-4,11-16H2 |
| InChIKey | WFMFECNPYADSFB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 90.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|