C22H24ClN5O5 — CID 4000572
[4-(2-chloro-6-nitrophenyl)piperazin-1-yl]-(3-nitro-4-piperidin-1-ylphenyl)methanone (PubChem CID 4000572) has the molecular formula C22H24ClN5O5 and a molecular weight of 473.92 g/mol. Its IUPAC name is [4-(2-chloro-6-nitrophenyl)piperazin-1-yl]-(3-nitro-4-piperidin-1-ylphenyl)methanone.
| Compound Name | [4-(2-chloro-6-nitrophenyl)piperazin-1-yl]-(3-nitro-4-piperidin-1-ylphenyl)methanone |
|---|---|
| PubChem CID | 4000572 |
| Molecular Formula | C22H24ClN5O5 |
| Molecular Weight | 473.92 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | [4-(2-chloro-6-nitrophenyl)piperazin-1-yl]-(3-nitro-4-piperidin-1-ylphenyl)methanone |
| SMILES | O=C(c1ccc(N2CCCCC2)c([N+](=O)[O-])c1)N1CCN(c2c(Cl)cccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C22H24ClN5O5/c23-17-5-4-6-19(27(30)31)21(17)25-11-13-26(14-12-25)22(29)16-7-8-18(20(15-16)28(32)33)24-9-2-1-3-10-24/h4-8,15H,1-3,9-14H2 |
| InChIKey | NGEAJZBDDRPIHH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 113.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.92 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|