C22H25FN4O3 — CID 7494443
[4-(4-fluorophenyl)piperazin-1-yl]-(3-nitro-4-piperidin-1-ylphenyl)methanone (PubChem CID 7494443) has the molecular formula C22H25FN4O3 and a molecular weight of 412.47 g/mol. Its IUPAC name is [4-(4-fluorophenyl)piperazin-1-yl]-(3-nitro-4-piperidin-1-ylphenyl)methanone.
| Compound Name | [4-(4-fluorophenyl)piperazin-1-yl]-(3-nitro-4-piperidin-1-ylphenyl)methanone |
|---|---|
| PubChem CID | 7494443 |
| Molecular Formula | C22H25FN4O3 |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | [4-(4-fluorophenyl)piperazin-1-yl]-(3-nitro-4-piperidin-1-ylphenyl)methanone |
| SMILES | O=C(c1ccc(N2CCCCC2)c([N+](=O)[O-])c1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H25FN4O3/c23-18-5-7-19(8-6-18)24-12-14-26(15-13-24)22(28)17-4-9-20(21(16-17)27(29)30)25-10-2-1-3-11-25/h4-9,16H,1-3,10-15H2 |
| InChIKey | BCBJYTKKYAGYFG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 69.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|