C30H30FN5O5 — CID 10209739
1-[1-[4-[4-(4-fluorophenyl)piperazine-1-carbonyl]-2-nitrophenyl]piperidin-4-yl]-4H-3,1-benzoxazin-2-one (PubChem CID 10209739) has the molecular formula C30H30FN5O5 and a molecular weight of 559.60 g/mol. Its IUPAC name is 1-[1-[4-[4-(4-fluorophenyl)piperazine-1-carbonyl]-2-nitrophenyl]piperidin-4-yl]-4H-3,1-benzoxazin-2-one.
| Compound Name | 1-[1-[4-[4-(4-fluorophenyl)piperazine-1-carbonyl]-2-nitrophenyl]piperidin-4-yl]-4H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 10209739 |
| Molecular Formula | C30H30FN5O5 |
| Molecular Weight | 559.60 g/mol |
| Exact Mass | 559.22 |
| IUPAC Name | 1-[1-[4-[4-(4-fluorophenyl)piperazine-1-carbonyl]-2-nitrophenyl]piperidin-4-yl]-4H-3,1-benzoxazin-2-one |
| SMILES | O=C(c1ccc(N2CCC(N3C(=O)OCc4ccccc43)CC2)c([N+](=O)[O-])c1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C30H30FN5O5/c31-23-6-8-24(9-7-23)32-15-17-34(18-16-32)29(37)21-5-10-27(28(19-21)36(39)40)33-13-11-25(12-14-33)35-26-4-2-1-3-22(26)20-41-30(35)38/h1-10,19,25H,11-18,20H2 |
| InChIKey | MCRLTTIJMOJKEY-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 99.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.60 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|