C29H30N6O5 — CID 10302462
1-[1-[2-nitro-4-(4-pyridin-2-ylpiperazine-1-carbonyl)phenyl]piperidin-4-yl]-4H-3,1-benzoxazin-2-one (PubChem CID 10302462) has the molecular formula C29H30N6O5 and a molecular weight of 542.60 g/mol. Its IUPAC name is 1-[1-[2-nitro-4-(4-pyridin-2-ylpiperazine-1-carbonyl)phenyl]piperidin-4-yl]-4H-3,1-benzoxazin-2-one.
| Compound Name | 1-[1-[2-nitro-4-(4-pyridin-2-ylpiperazine-1-carbonyl)phenyl]piperidin-4-yl]-4H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 10302462 |
| Molecular Formula | C29H30N6O5 |
| Molecular Weight | 542.60 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | 1-[1-[2-nitro-4-(4-pyridin-2-ylpiperazine-1-carbonyl)phenyl]piperidin-4-yl]-4H-3,1-benzoxazin-2-one |
| SMILES | O=C(c1ccc(N2CCC(N3C(=O)OCc4ccccc43)CC2)c([N+](=O)[O-])c1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C29H30N6O5/c36-28(33-17-15-32(16-18-33)27-7-3-4-12-30-27)21-8-9-25(26(19-21)35(38)39)31-13-10-23(11-14-31)34-24-6-2-1-5-22(24)20-40-29(34)37/h1-9,12,19,23H,10-11,13-18,20H2 |
| InChIKey | FEARYEFDGXLQEB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 112.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.60 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|