C31H31N5O5 — CID 17091440
N-[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]phenyl]-3-nitro-4-piperidin-1-ylbenzamide (PubChem CID 17091440) has the molecular formula C31H31N5O5 and a molecular weight of 553.62 g/mol. Its IUPAC name is N-[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]phenyl]-3-nitro-4-piperidin-1-ylbenzamide.
| Compound Name | N-[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]phenyl]-3-nitro-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 17091440 |
| Molecular Formula | C31H31N5O5 |
| Molecular Weight | 553.62 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | N-[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]phenyl]-3-nitro-4-piperidin-1-ylbenzamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)c3cc4ccccc4o3)CC2)cc1)c1ccc(N2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H31N5O5/c37-30(23-8-13-26(27(20-23)36(39)40)34-14-4-1-5-15-34)32-24-9-11-25(12-10-24)33-16-18-35(19-17-33)31(38)29-21-22-6-2-3-7-28(22)41-29/h2-3,6-13,20-21H,1,4-5,14-19H2,(H,32,37) |
| InChIKey | FSETZOYMNSGOHG-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 112.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.62 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|