C26H32N6O5S — CID 17317520
N-[[4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide (PubChem CID 17317520) has the molecular formula C26H32N6O5S and a molecular weight of 540.65 g/mol. Its IUPAC name is N-[[4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide.
| Compound Name | N-[[4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 17317520 |
| Molecular Formula | C26H32N6O5S |
| Molecular Weight | 540.65 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | N-[[4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide |
| SMILES | CC(C)C(=O)N1CCN(c2ccc(NC(=S)NC(=O)c3ccc(N4CCOCC4)c([N+](=O)[O-])c3)cc2)CC1 |
| InChI | InChI=1S/C26H32N6O5S/c1-18(2)25(34)31-11-9-29(10-12-31)21-6-4-20(5-7-21)27-26(38)28-24(33)19-3-8-22(23(17-19)32(35)36)30-13-15-37-16-14-30/h3-8,17-18H,9-16H2,1-2H3,(H2,27,28,33,38) |
| InChIKey | IYXKPCLBWPIPSE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 120.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.65 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|