C26H26N4O3S — CID 17115946
N-[[4-(4-benzoylpiperazin-1-yl)phenyl]carbamothioyl]-2-phenoxyacetamide (PubChem CID 17115946) has the molecular formula C26H26N4O3S and a molecular weight of 474.59 g/mol. Its IUPAC name is N-[[4-(4-benzoylpiperazin-1-yl)phenyl]carbamothioyl]-2-phenoxyacetamide.
| Compound Name | N-[[4-(4-benzoylpiperazin-1-yl)phenyl]carbamothioyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 17115946 |
| Molecular Formula | C26H26N4O3S |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | N-[[4-(4-benzoylpiperazin-1-yl)phenyl]carbamothioyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)NC(=S)Nc1ccc(N2CCN(C(=O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H26N4O3S/c31-24(19-33-23-9-5-2-6-10-23)28-26(34)27-21-11-13-22(14-12-21)29-15-17-30(18-16-29)25(32)20-7-3-1-4-8-20/h1-14H,15-19H2,(H2,27,28,31,34) |
| InChIKey | UUGCHFZRHBWOGF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|