C17H16N2O4S — CID 692113
methyl 4-[(2-phenoxyacetyl)carbamothioylamino]benzoate (PubChem CID 692113) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is methyl 4-[(2-phenoxyacetyl)carbamothioylamino]benzoate.
| Compound Name | methyl 4-[(2-phenoxyacetyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 692113 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | methyl 4-[(2-phenoxyacetyl)carbamothioylamino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=S)NC(=O)COc2ccccc2)cc1 |
| InChI | InChI=1S/C17H16N2O4S/c1-22-16(21)12-7-9-13(10-8-12)18-17(24)19-15(20)11-23-14-5-3-2-4-6-14/h2-10H,11H2,1H3,(H2,18,19,20,24) |
| InChIKey | MVFIEAIGEZCYMK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|