C18H18N2O3S — CID 4628169
methyl 4-(3-phenylpropanoylcarbamothioylamino)benzoate (PubChem CID 4628169) has the molecular formula C18H18N2O3S and a molecular weight of 342.42 g/mol. Its IUPAC name is methyl 4-(3-phenylpropanoylcarbamothioylamino)benzoate.
| Compound Name | methyl 4-(3-phenylpropanoylcarbamothioylamino)benzoate |
|---|---|
| PubChem CID | 4628169 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | methyl 4-(3-phenylpropanoylcarbamothioylamino)benzoate |
| SMILES | COC(=O)c1ccc(NC(=S)NC(=O)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H18N2O3S/c1-23-17(22)14-8-10-15(11-9-14)19-18(24)20-16(21)12-7-13-5-3-2-4-6-13/h2-6,8-11H,7,12H2,1H3,(H2,19,20,21,24) |
| InChIKey | SBFYACAMBNTKRN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|