C17H15ClN2O4S — CID 5254098
methyl 4-[[2-(2-chlorophenoxy)acetyl]carbamothioylamino]benzoate (PubChem CID 5254098) has the molecular formula C17H15ClN2O4S and a molecular weight of 378.84 g/mol. Its IUPAC name is methyl 4-[[2-(2-chlorophenoxy)acetyl]carbamothioylamino]benzoate.
| Compound Name | methyl 4-[[2-(2-chlorophenoxy)acetyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 5254098 |
| Molecular Formula | C17H15ClN2O4S |
| Molecular Weight | 378.84 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | methyl 4-[[2-(2-chlorophenoxy)acetyl]carbamothioylamino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=S)NC(=O)COc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C17H15ClN2O4S/c1-23-16(22)11-6-8-12(9-7-11)19-17(25)20-15(21)10-24-14-5-3-2-4-13(14)18/h2-9H,10H2,1H3,(H2,19,20,21,25) |
| InChIKey | KKKPDFUVQQNRDY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.84 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|