C15H11Br2ClN2O3S — CID 5259058
2-(2-chlorophenoxy)-N-[(3,5-dibromo-4-hydroxyphenyl)carbamothioyl]acetamide (PubChem CID 5259058) has the molecular formula C15H11Br2ClN2O3S and a molecular weight of 494.59 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-[(3,5-dibromo-4-hydroxyphenyl)carbamothioyl]acetamide.
| Compound Name | 2-(2-chlorophenoxy)-N-[(3,5-dibromo-4-hydroxyphenyl)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 5259058 |
| Molecular Formula | C15H11Br2ClN2O3S |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 491.85 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-[(3,5-dibromo-4-hydroxyphenyl)carbamothioyl]acetamide |
| SMILES | O=C(COc1ccccc1Cl)NC(=S)Nc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C15H11Br2ClN2O3S/c16-9-5-8(6-10(17)14(9)22)19-15(24)20-13(21)7-23-12-4-2-1-3-11(12)18/h1-6,22H,7H2,(H2,19,20,21,24) |
| InChIKey | UICNIPMANLXCDF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|