C22H27N3O2S — CID 19188430
4-phenoxy-N-[(4-piperidin-1-ylphenyl)carbamothioyl]butanamide (PubChem CID 19188430) has the molecular formula C22H27N3O2S and a molecular weight of 397.54 g/mol. Its IUPAC name is 4-phenoxy-N-[(4-piperidin-1-ylphenyl)carbamothioyl]butanamide.
| Compound Name | 4-phenoxy-N-[(4-piperidin-1-ylphenyl)carbamothioyl]butanamide |
|---|---|
| PubChem CID | 19188430 |
| Molecular Formula | C22H27N3O2S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 4-phenoxy-N-[(4-piperidin-1-ylphenyl)carbamothioyl]butanamide |
| SMILES | O=C(CCCOc1ccccc1)NC(=S)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C22H27N3O2S/c26-21(10-7-17-27-20-8-3-1-4-9-20)24-22(28)23-18-11-13-19(14-12-18)25-15-5-2-6-16-25/h1,3-4,8-9,11-14H,2,5-7,10,15-17H2,(H2,23,24,26,28) |
| InChIKey | OKFGQNTZDHNPQT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|