C21H24N5OS+ — CID 9092458
N-[4-(4-benzylpiperazin-4-ium-1-yl)phenyl]-4-methylthiadiazole-5-carboxamide (PubChem CID 9092458) has the molecular formula C21H24N5OS+ and a molecular weight of 394.52 g/mol. Its IUPAC name is N-[4-(4-benzylpiperazin-4-ium-1-yl)phenyl]-4-methylthiadiazole-5-carboxamide.
| Compound Name | N-[4-(4-benzylpiperazin-4-ium-1-yl)phenyl]-4-methylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 9092458 |
| Molecular Formula | C21H24N5OS+ |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | N-[4-(4-benzylpiperazin-4-ium-1-yl)phenyl]-4-methylthiadiazole-5-carboxamide |
| SMILES | Cc1nnsc1C(=O)Nc1ccc(N2CC[NH+](Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C21H23N5OS/c1-16-20(28-24-23-16)21(27)22-18-7-9-19(10-8-18)26-13-11-25(12-14-26)15-17-5-3-2-4-6-17/h2-10H,11-15H2,1H3,(H,22,27)/p+1 |
| InChIKey | SCNCTOGQEAZEJY-UHFFFAOYSA-O |
| XLogP | 2.00 |
| TPSA | 62.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|