C17H22N6O2S — CID 8968237
4-methyl-N'-[3-(4-phenylpiperazin-1-yl)propanoyl]thiadiazole-5-carbohydrazide (PubChem CID 8968237) has the molecular formula C17H22N6O2S and a molecular weight of 374.47 g/mol. Its IUPAC name is 4-methyl-N'-[3-(4-phenylpiperazin-1-yl)propanoyl]thiadiazole-5-carbohydrazide.
| Compound Name | 4-methyl-N'-[3-(4-phenylpiperazin-1-yl)propanoyl]thiadiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 8968237 |
| Molecular Formula | C17H22N6O2S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 4-methyl-N'-[3-(4-phenylpiperazin-1-yl)propanoyl]thiadiazole-5-carbohydrazide |
| SMILES | Cc1nnsc1C(=O)NNC(=O)CCN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C17H22N6O2S/c1-13-16(26-21-18-13)17(25)20-19-15(24)7-8-22-9-11-23(12-10-22)14-5-3-2-4-6-14/h2-6H,7-12H2,1H3,(H,19,24)(H,20,25) |
| InChIKey | NXADRZJTJHUSEX-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|