C20H22ClFN4O2 — CID 7551003
2-chloro-6-fluoro-N'-[3-(4-phenylpiperazin-1-yl)propanoyl]benzohydrazide (PubChem CID 7551003) has the molecular formula C20H22ClFN4O2 and a molecular weight of 404.87 g/mol. Its IUPAC name is 2-chloro-6-fluoro-N'-[3-(4-phenylpiperazin-1-yl)propanoyl]benzohydrazide.
| Compound Name | 2-chloro-6-fluoro-N'-[3-(4-phenylpiperazin-1-yl)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 7551003 |
| Molecular Formula | C20H22ClFN4O2 |
| Molecular Weight | 404.87 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 2-chloro-6-fluoro-N'-[3-(4-phenylpiperazin-1-yl)propanoyl]benzohydrazide |
| SMILES | O=C(CCN1CCN(c2ccccc2)CC1)NNC(=O)c1c(F)cccc1Cl |
| InChI | InChI=1S/C20H22ClFN4O2/c21-16-7-4-8-17(22)19(16)20(28)24-23-18(27)9-10-25-11-13-26(14-12-25)15-5-2-1-3-6-15/h1-8H,9-14H2,(H,23,27)(H,24,28) |
| InChIKey | RMKBENOQBNCEBW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.87 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|