C21H24Cl2N4O3 — CID 26523702
N'-[2-(2,4-dichlorophenoxy)acetyl]-3-(4-phenylpiperazin-1-yl)propanehydrazide (PubChem CID 26523702) has the molecular formula C21H24Cl2N4O3 and a molecular weight of 451.35 g/mol. Its IUPAC name is N'-[2-(2,4-dichlorophenoxy)acetyl]-3-(4-phenylpiperazin-1-yl)propanehydrazide.
| Compound Name | N'-[2-(2,4-dichlorophenoxy)acetyl]-3-(4-phenylpiperazin-1-yl)propanehydrazide |
|---|---|
| PubChem CID | 26523702 |
| Molecular Formula | C21H24Cl2N4O3 |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | N'-[2-(2,4-dichlorophenoxy)acetyl]-3-(4-phenylpiperazin-1-yl)propanehydrazide |
| SMILES | O=C(CCN1CCN(c2ccccc2)CC1)NNC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H24Cl2N4O3/c22-16-6-7-19(18(23)14-16)30-15-21(29)25-24-20(28)8-9-26-10-12-27(13-11-26)17-4-2-1-3-5-17/h1-7,14H,8-13,15H2,(H,24,28)(H,25,29) |
| InChIKey | CXCJKOFLQIGROB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|