C23H28N4O4 — CID 7891748
N'-[2-(4-acetylphenoxy)acetyl]-3-(4-phenylpiperazin-1-yl)propanehydrazide (PubChem CID 7891748) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is N'-[2-(4-acetylphenoxy)acetyl]-3-(4-phenylpiperazin-1-yl)propanehydrazide.
| Compound Name | N'-[2-(4-acetylphenoxy)acetyl]-3-(4-phenylpiperazin-1-yl)propanehydrazide |
|---|---|
| PubChem CID | 7891748 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | N'-[2-(4-acetylphenoxy)acetyl]-3-(4-phenylpiperazin-1-yl)propanehydrazide |
| SMILES | CC(=O)c1ccc(OCC(=O)NNC(=O)CCN2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C23H28N4O4/c1-18(28)19-7-9-21(10-8-19)31-17-23(30)25-24-22(29)11-12-26-13-15-27(16-14-26)20-5-3-2-4-6-20/h2-10H,11-17H2,1H3,(H,24,29)(H,25,30) |
| InChIKey | MMJGZLFGAXARDD-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|