C29H30N4O4 — CID 26523365
3-(phenoxymethyl)-N'-[3-(4-phenylpiperazin-1-yl)propanoyl]-1-benzofuran-2-carbohydrazide (PubChem CID 26523365) has the molecular formula C29H30N4O4 and a molecular weight of 498.58 g/mol. Its IUPAC name is 3-(phenoxymethyl)-N'-[3-(4-phenylpiperazin-1-yl)propanoyl]-1-benzofuran-2-carbohydrazide.
| Compound Name | 3-(phenoxymethyl)-N'-[3-(4-phenylpiperazin-1-yl)propanoyl]-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 26523365 |
| Molecular Formula | C29H30N4O4 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | 3-(phenoxymethyl)-N'-[3-(4-phenylpiperazin-1-yl)propanoyl]-1-benzofuran-2-carbohydrazide |
| SMILES | O=C(CCN1CCN(c2ccccc2)CC1)NNC(=O)c1oc2ccccc2c1COc1ccccc1 |
| InChI | InChI=1S/C29H30N4O4/c34-27(15-16-32-17-19-33(20-18-32)22-9-3-1-4-10-22)30-31-29(35)28-25(21-36-23-11-5-2-6-12-23)24-13-7-8-14-26(24)37-28/h1-14H,15-21H2,(H,30,34)(H,31,35) |
| InChIKey | DTSIZTNQMUYGAP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|