C23H19NO5S — CID 18775166
N-(4-methylsulfonylphenyl)-3-(phenoxymethyl)-1-benzofuran-2-carboxamide (PubChem CID 18775166) has the molecular formula C23H19NO5S and a molecular weight of 421.47 g/mol. Its IUPAC name is N-(4-methylsulfonylphenyl)-3-(phenoxymethyl)-1-benzofuran-2-carboxamide.
| Compound Name | N-(4-methylsulfonylphenyl)-3-(phenoxymethyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 18775166 |
| Molecular Formula | C23H19NO5S |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | N-(4-methylsulfonylphenyl)-3-(phenoxymethyl)-1-benzofuran-2-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)c2oc3ccccc3c2COc2ccccc2)cc1 |
| InChI | InChI=1S/C23H19NO5S/c1-30(26,27)18-13-11-16(12-14-18)24-23(25)22-20(15-28-17-7-3-2-4-8-17)19-9-5-6-10-21(19)29-22/h2-14H,15H2,1H3,(H,24,25) |
| InChIKey | DJQNNVVRHQFNMI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |