C28H28N2O7S — CID 4685045
[2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 3-(phenoxymethyl)-1-benzofuran-2-carboxylate (PubChem CID 4685045) has the molecular formula C28H28N2O7S and a molecular weight of 536.61 g/mol. Its IUPAC name is [2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 3-(phenoxymethyl)-1-benzofuran-2-carboxylate.
| Compound Name | [2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 3-(phenoxymethyl)-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 4685045 |
| Molecular Formula | C28H28N2O7S |
| Molecular Weight | 536.61 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | [2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 3-(phenoxymethyl)-1-benzofuran-2-carboxylate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)COC(=O)c2oc3ccccc3c2COc2ccccc2)cc1 |
| InChI | InChI=1S/C28H28N2O7S/c1-3-30(4-2)38(33,34)22-16-14-20(15-17-22)29-26(31)19-36-28(32)27-24(18-35-21-10-6-5-7-11-21)23-12-8-9-13-25(23)37-27/h5-17H,3-4,18-19H2,1-2H3,(H,29,31) |
| InChIKey | LTCPEFNCKZZUJB-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.61 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |