C22H24N2O7S — CID 16520047
[2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 3-(ethoxymethyl)-1-benzofuran-2-carboxylate (PubChem CID 16520047) has the molecular formula C22H24N2O7S and a molecular weight of 460.51 g/mol. Its IUPAC name is [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 3-(ethoxymethyl)-1-benzofuran-2-carboxylate.
| Compound Name | [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 3-(ethoxymethyl)-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 16520047 |
| Molecular Formula | C22H24N2O7S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 3-(ethoxymethyl)-1-benzofuran-2-carboxylate |
| SMILES | CCOCc1c(C(=O)OCC(=O)Nc2cccc(S(=O)(=O)N(C)C)c2)oc2ccccc12 |
| InChI | InChI=1S/C22H24N2O7S/c1-4-29-13-18-17-10-5-6-11-19(17)31-21(18)22(26)30-14-20(25)23-15-8-7-9-16(12-15)32(27,28)24(2)3/h5-12H,4,13-14H2,1-3H3,(H,23,25) |
| InChIKey | INRMCXCSYXZVHU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |