C18H23NO5 — CID 2660979
[2-(tert-butylamino)-2-oxoethyl] 3-(ethoxymethyl)-1-benzofuran-2-carboxylate (PubChem CID 2660979) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl] 3-(ethoxymethyl)-1-benzofuran-2-carboxylate.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl] 3-(ethoxymethyl)-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 2660979 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl] 3-(ethoxymethyl)-1-benzofuran-2-carboxylate |
| SMILES | CCOCc1c(C(=O)OCC(=O)NC(C)(C)C)oc2ccccc12 |
| InChI | InChI=1S/C18H23NO5/c1-5-22-10-13-12-8-6-7-9-14(12)24-16(13)17(21)23-11-15(20)19-18(2,3)4/h6-9H,5,10-11H2,1-4H3,(H,19,20) |
| InChIKey | XVSZCIQJUPJZHM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |