C16H17NO7 — CID 7551159
[2-(ethoxycarbonylamino)-2-oxoethyl] 3-(methoxymethyl)-1-benzofuran-2-carboxylate (PubChem CID 7551159) has the molecular formula C16H17NO7 and a molecular weight of 335.31 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl] 3-(methoxymethyl)-1-benzofuran-2-carboxylate.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 3-(methoxymethyl)-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 7551159 |
| Molecular Formula | C16H17NO7 |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 3-(methoxymethyl)-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)NC(=O)COC(=O)c1oc2ccccc2c1COC |
| InChI | InChI=1S/C16H17NO7/c1-3-22-16(20)17-13(18)9-23-15(19)14-11(8-21-2)10-6-4-5-7-12(10)24-14/h4-7H,3,8-9H2,1-2H3,(H,17,18,20) |
| InChIKey | DZGQGAOWACMZMQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |