C20H27NO5 — CID 18202227
[2-(heptan-2-ylamino)-2-oxoethyl] 3-(methoxymethyl)-1-benzofuran-2-carboxylate (PubChem CID 18202227) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is [2-(heptan-2-ylamino)-2-oxoethyl] 3-(methoxymethyl)-1-benzofuran-2-carboxylate.
| Compound Name | [2-(heptan-2-ylamino)-2-oxoethyl] 3-(methoxymethyl)-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 18202227 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | [2-(heptan-2-ylamino)-2-oxoethyl] 3-(methoxymethyl)-1-benzofuran-2-carboxylate |
| SMILES | CCCCCC(C)NC(=O)COC(=O)c1oc2ccccc2c1COC |
| InChI | InChI=1S/C20H27NO5/c1-4-5-6-9-14(2)21-18(22)13-25-20(23)19-16(12-24-3)15-10-7-8-11-17(15)26-19/h7-8,10-11,14H,4-6,9,12-13H2,1-3H3,(H,21,22) |
| InChIKey | RGZDUCRAZZJNQC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|