C21H20N2O6 — CID 2648017
[2-(ethylcarbamoylamino)-2-oxoethyl] 3-(phenoxymethyl)-1-benzofuran-2-carboxylate (PubChem CID 2648017) has the molecular formula C21H20N2O6 and a molecular weight of 396.40 g/mol. Its IUPAC name is [2-(ethylcarbamoylamino)-2-oxoethyl] 3-(phenoxymethyl)-1-benzofuran-2-carboxylate.
| Compound Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 3-(phenoxymethyl)-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 2648017 |
| Molecular Formula | C21H20N2O6 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 3-(phenoxymethyl)-1-benzofuran-2-carboxylate |
| SMILES | CCNC(=O)NC(=O)COC(=O)c1oc2ccccc2c1COc1ccccc1 |
| InChI | InChI=1S/C21H20N2O6/c1-2-22-21(26)23-18(24)13-28-20(25)19-16(12-27-14-8-4-3-5-9-14)15-10-6-7-11-17(15)29-19/h3-11H,2,12-13H2,1H3,(H2,22,23,24,26) |
| InChIKey | SHPBVSLVNCETJF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |