cyanomethyl 3-(phenoxymethyl)-1-benzofuran-2-carboxylate

C18H13NO4 — CID 2644868

IUPACcyanomethyl 3-(phenoxymethyl)-1-benzofuran-2-carboxylate
SMILESN#CCOC(=O)c1oc2ccccc2c1COc1ccccc1
InChIInChI=1S/C18H13NO4/c19-10-11-21-18(20)17-15(12-22-13-6-2-1-3-7-13)14-8-4-5-9-16(14)23-17/h1-9H,11-12H2
InChIKeyHRWCLNWUNCBMRX-UHFFFAOYSA-N
MW307.31 g/mol
LogP3.69
Rot. Bonds5

About cyanomethyl 3-(phenoxymethyl)-1-benzofuran-2-carboxylate

cyanomethyl 3-(phenoxymethyl)-1-benzofuran-2-carboxylate (PubChem CID 2644868) has the molecular formula C18H13NO4 and a molecular weight of 307.31 g/mol. Its IUPAC name is cyanomethyl 3-(phenoxymethyl)-1-benzofuran-2-carboxylate.

Molecular Properties

Compound Namecyanomethyl 3-(phenoxymethyl)-1-benzofuran-2-carboxylate
PubChem CID2644868
Molecular FormulaC18H13NO4
Molecular Weight307.31 g/mol
Exact Mass307.08
IUPAC Namecyanomethyl 3-(phenoxymethyl)-1-benzofuran-2-carboxylate
SMILESN#CCOC(=O)c1oc2ccccc2c1COc1ccccc1
InChIInChI=1S/C18H13NO4/c19-10-11-21-18(20)17-15(12-22-13-6-2-1-3-7-13)14-8-4-5-9-16(14)23-17/h1-9H,11-12H2
InChIKeyHRWCLNWUNCBMRX-UHFFFAOYSA-N
XLogP3.69
TPSA72.46 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500307.31
LogP ≤ 53.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze cyanomethyl 3-(phenoxymethyl)-1-benzofuran-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cyanomethyl 3-(phenoxymethyl)-1-benzofuran-2-carboxylate?
The IUPAC name of cyanomethyl 3-(phenoxymethyl)-1-benzofuran-2-carboxylate (CID 2644868) is cyanomethyl 3-(phenoxymethyl)-1-benzofuran-2-carboxylate.
What is the SMILES notation for cyanomethyl 3-(phenoxymethyl)-1-benzofuran-2-carboxylate?
The canonical SMILES for cyanomethyl 3-(phenoxymethyl)-1-benzofuran-2-carboxylate is N#CCOC(=O)c1oc2ccccc2c1COc1ccccc1.
What is the InChIKey of cyanomethyl 3-(phenoxymethyl)-1-benzofuran-2-carboxylate?
The InChIKey is HRWCLNWUNCBMRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13NO4/c19-10-11-21-18(20)17-15(12-22-13-6-2-1-3-7-13)14-8-4-5-9-16(14)23-17/h1-9H,11-12H2.
What are the key properties of cyanomethyl 3-(phenoxymethyl)-1-benzofuran-2-carboxylate?
cyanomethyl 3-(phenoxymethyl)-1-benzofuran-2-carboxylate has a molecular weight of 307.31 g/mol, XLogP of 3.69, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyanomethyl 3-(phenoxymethyl)-1-benzofuran-2-carboxylate is sourced from PubChem (CID 2644868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).